<script LANGUAGE="JavaScript1.1" SRC="../../../marvin.js"></script>
<script LANGUAGE="JavaScript1.1">
<!--
mview_begin("../../..", 300, 300);
mview_param("rows", "2");
mview_param("cols", "2");
mview_param("cell0", "|../../../mols-2d/caffeine.csmol");
mview_param("cell1", "|O[C@H](\C=C\[C@@H](O)C1=CC=CC=C1)C2=CC=CC=C2");
mview_param("cell2", "|Ethane\n"
+" Marvin 07119915552D\n"
+"\n"
+" 2 1 0 0 0 0 0 0 0 0999 V2000\n"
+" -0.5625 1.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n"
+" -0.5625 0.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n"
+" 1 2 1 0 0 0 0\n"
+"M END");
mview_param("cell3", "|C[C@]12CC[C@@H]3[C@H](CC[C@H]4CC(=O)C(\C[C@]34C)=C\O)[C@@H]1CCC(=O)O2");
mview_end();
//-->
</script>
The "|" characters before the Molfile names/contents
and SMILES strings are separator characters.
They seem to be superfluous now, because each cell contains only one
object, no need to separate anything.
But you will see their significance in the forthcoming examples.
This is only a very basic example. In reality, the greatest advantages of a molecule table over an html table with many small applets can be seen if you have a large number of molecules. This may be the case if the molecules are the result of a database search. 100 separate molecule applets consumes much more memory and are much slower then one molecule table with 100 molecules.
If you have a large number of molecules, it would be nice if the user would see some additional information next to the molecule. You will see how to do this and even more in the next example.